2-BroMo-5-(isopropyl) thiazole
2-Bromo-5-isopropyl-1,3-thiazole
CAS: 1159817-16-9
Molecular Formula: C6H8BrNS
2-BroMo-5-(isopropyl) thiazole - Names and Identifiers
| Name | 2-Bromo-5-isopropyl-1,3-thiazole |
| Synonyms | 2-Bromo-5-isopropylthiazole 2-BroMo-5-(isopropyl) thiazole 2-Bromo-5-(iso-propyl)thiazole 2-Bromo-5-isopropyl-1,3-thiazole Thiazole, 2-bromo-5-(1-methylethyl)- 2-broManyl-5-propan-2-yl-1,3-thiazole |
| CAS | 1159817-16-9 |
| InChI | InChI=1S/C6H8BrNS/c1-4(2)5-3-8-6(7)9-5/h3-4H,1-2H3 |
2-BroMo-5-(isopropyl) thiazole - Physico-chemical Properties
| Molecular Formula | C6H8BrNS |
| Molar Mass | 206.1 |
| Density | 1.489±0.06 g/cm3(Predicted) |
| Boling Point | 214.8±9.0 °C(Predicted) |
| pKa | 1.22±0.10(Predicted) |
| Storage Condition | under inert gas (nitrogen or Argon) at 2-8°C |
2-BroMo-5-(isopropyl) thiazole - Introduction
5-Isopropyl-2-bromothiazole is an organic compound with the following properties:
1. Appearance: 5-isopropyl-2-bromothiazole is a colorless liquid or solid with a special smell.
2. Solubility: It can be dissolved in many organic solvents, such as ethanol and dimethylformamide, but it is difficult to dissolve in water.
3. Stability: It is relatively stable at room temperature, but dangerous reactions may occur when encountering strong oxidants.
The main uses of 5-isopropyl-2-bromothiazole are as follows:
1. Pesticide: It can be used as a raw material for pesticides to prevent and control diseases and insect pests on crops.
2. medicine: the compound can be used for the preparation of certain drugs, with certain biological activity.
3. Chemical synthesis: It can be used as an intermediate for the synthesis of organic compounds and participate in various organic synthesis reactions.
The preparation method of 5-isopropyl-2-bromothiazole can be realized by the following steps:
1. Sulfuric acid catalytic method: reaction of isopropyl ketone with bromine and sulfuric acid to prepare 5-isopropyl-2-bromothiazole at appropriate temperature and reaction conditions.
2. Bromination method: 2-bromothiazole is reacted with vinylacetone to obtain 5-isopropyl-2-bromothiazole under appropriate reaction conditions.
When using and handling 5-isopropyl-2-bromothiazole, the following safety information should be followed:
1. gas/liquid can not be inhaled: avoid inhaling gas or liquid, and ensure adequate ventilation when using.
2. protective measures: must wear appropriate protective gloves and glasses, wear breathing apparatus.
3. fire prevention measures: avoid contact with fire source and high temperature materials, and keep away from heat source and flammable materials when stored.
4. Placement and storage: It should be sealed and stored in a dry, cool place, away from combustibles and oxidants.
5. Waste disposal: proper disposal of waste in accordance with local laws and regulations.
1. Appearance: 5-isopropyl-2-bromothiazole is a colorless liquid or solid with a special smell.
2. Solubility: It can be dissolved in many organic solvents, such as ethanol and dimethylformamide, but it is difficult to dissolve in water.
3. Stability: It is relatively stable at room temperature, but dangerous reactions may occur when encountering strong oxidants.
The main uses of 5-isopropyl-2-bromothiazole are as follows:
1. Pesticide: It can be used as a raw material for pesticides to prevent and control diseases and insect pests on crops.
2. medicine: the compound can be used for the preparation of certain drugs, with certain biological activity.
3. Chemical synthesis: It can be used as an intermediate for the synthesis of organic compounds and participate in various organic synthesis reactions.
The preparation method of 5-isopropyl-2-bromothiazole can be realized by the following steps:
1. Sulfuric acid catalytic method: reaction of isopropyl ketone with bromine and sulfuric acid to prepare 5-isopropyl-2-bromothiazole at appropriate temperature and reaction conditions.
2. Bromination method: 2-bromothiazole is reacted with vinylacetone to obtain 5-isopropyl-2-bromothiazole under appropriate reaction conditions.
When using and handling 5-isopropyl-2-bromothiazole, the following safety information should be followed:
1. gas/liquid can not be inhaled: avoid inhaling gas or liquid, and ensure adequate ventilation when using.
2. protective measures: must wear appropriate protective gloves and glasses, wear breathing apparatus.
3. fire prevention measures: avoid contact with fire source and high temperature materials, and keep away from heat source and flammable materials when stored.
4. Placement and storage: It should be sealed and stored in a dry, cool place, away from combustibles and oxidants.
5. Waste disposal: proper disposal of waste in accordance with local laws and regulations.
Last Update：2024-04-09 02:00:41
Supplier List
Product Name: 2-BroMo-5-(isopropyl) thiazole Visit Supplier Webpage Request for quotation
CAS: 1159817-16-9
Tel: 18301782025
Email: 3008007409@qq.com
Mobile: 18021002903
QQ: 3008007409
Wechat: 18301782025
CAS: 1159817-16-9
Tel: 18301782025
Email: 3008007409@qq.com
Mobile: 18021002903
QQ: 3008007409
Wechat: 18301782025
Product Name: 2-Bromo-5-(isopropyl) thiazole Request for quotation
CAS: 1159817-16-9
Tel: 0086-13605431940
Email: xuli678323@126.com
Mobile: +86-13605431940
QQ: 56860987
Wechat: 13605431940
WhatsApp: 13605431940
CAS: 1159817-16-9
Tel: 0086-13605431940
Email: xuli678323@126.com
Mobile: +86-13605431940
QQ: 56860987
Wechat: 13605431940
WhatsApp: 13605431940
Product Name: 2-BroMo-5-(isopropyl) thiazole Visit Supplier Webpage Request for quotation
CAS: 1159817-16-9
Tel: 18301782025
Email: 3008007409@qq.com
Mobile: 18021002903
QQ: 3008007409
Wechat: 18301782025
CAS: 1159817-16-9
Tel: 18301782025
Email: 3008007409@qq.com
Mobile: 18021002903
QQ: 3008007409
Wechat: 18301782025
Product Name: 2-Bromo-5-(isopropyl) thiazole Request for quotation
CAS: 1159817-16-9
Tel: 0086-13605431940
Email: xuli678323@126.com
Mobile: +86-13605431940
QQ: 56860987
Wechat: 13605431940
WhatsApp: 13605431940
CAS: 1159817-16-9
Tel: 0086-13605431940
Email: xuli678323@126.com
Mobile: +86-13605431940
QQ: 56860987
Wechat: 13605431940
WhatsApp: 13605431940
View History